CAS 1602279-99-1 appears in our catalog under these names: 1-Chloro-7,8,9,10-tetrahydropyrazino(1,2-b)indazole, 1-Chloro-7h,8h,9h,10h-pyrazino[1,2-b]indazole, 90%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 50mg, 0,5g, 1g, 250mg.
1-chloro-7,8,9,10-tetrahydropyrazino[1,2-b]indazole (CAS 1602279-99-1) is a chemical compound with the molecular formula C10H10ClN3 and a molecular weight of 207.66 g/mol. IUPAC name: 1-chloro-7,8,9,10-tetrahydropyrazino[1,2-b]indazole. InChIKey: CQXJTCSDIJJBHH-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3 |
|---|---|
| Molecular weight | 207.66 g/mol |
| IUPAC name | 1-chloro-7,8,9,10-tetrahydropyrazino[1,2-b]indazole |
| InChIKey | CQXJTCSDIJJBHH-UHFFFAOYSA-N |
| SMILES | C1CCC2=NN3C=CN=C(C3=C2C1)Cl |
Computed by PubChem (NCBI)