Products 1602964-92-0

CAS 1602964-92-0 is the registry number for 3-(2,2-Dimethylthiomorpholin-4-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-(2,2-dimethylthiomorpholin-4-yl)propanoic acid (CAS 1602964-92-0) is a chemical compound with the molecular formula C9H17NO2S and a molecular weight of 203.30 g/mol. IUPAC name: 3-(2,2-dimethylthiomorpholin-4-yl)propanoic acid. InChIKey: CMLJLZAWYXUMGM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17NO2S
Molecular weight203.30 g/mol
IUPAC name3-(2,2-dimethylthiomorpholin-4-yl)propanoic acid
InChIKeyCMLJLZAWYXUMGM-UHFFFAOYSA-N
SMILESCC1(CN(CCS1)CCC(=O)O)C

Computed by PubChem (NCBI)