CAS 1603461-60-4 is the registry number for 1-(2-Nitrophenyl)ethyl methanesulfonate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2-nitrophenyl)ethyl methanesulfonate (CAS 1603461-60-4) is a chemical compound with the molecular formula C9H11NO5S and a molecular weight of 245.25 g/mol. IUPAC name: 1-(2-nitrophenyl)ethyl methanesulfonate. InChIKey: DUXKWXRHIABKLV-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5S |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | 1-(2-nitrophenyl)ethyl methanesulfonate |
| InChIKey | DUXKWXRHIABKLV-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1[N+](=O)[O-])OS(=O)(=O)C |
Computed by PubChem (NCBI)