CAS 1604-08-6 appears in our catalog under these names: 9H-Xanthene-9-carbohydrazide, 95%, 9H-xanthene-9-carbohydrazide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g.
9H-xanthene-9-carbohydrazide (CAS 1604-08-6) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 9H-xanthene-9-carbohydrazide. InChIKey: VDVNAWMSFFMKDT-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 9H-xanthene-9-carbohydrazide |
| InChIKey | VDVNAWMSFFMKDT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C3O2)C(=O)NN |
Computed by PubChem (NCBI)