Products 160434-49-1
CAS 160434-49-1 appears in our catalog under these names: 3–Bromo–4–fluorocinnamic acid, 3-Bromo-4-fluorocinnamic acid, 98% (E), 98% (E), 3-Bromo-4-fluorocinnamic acid, min. 95 %, 10 g, 3-Bromo-4-fluorocinnamic acid, 98%, 3-Bromo-4-fluorocinnamic acid, 98% (E). Offered by: GLPBio, Chemat, Roth, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g, 10g.
3-(3-bromo-4-fluorophenyl)prop-2-enoic acid (CAS 160434-49-1) is a chemical compound with the molecular formula C9H6BrFO2 and a molecular weight of 245.04 g/mol. IUPAC name: 3-(3-bromo-4-fluorophenyl)prop-2-enoic acid. InChIKey: ZNIGVADAKXOMQH-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO2 |
|---|---|
| Molecular weight | 245.04 g/mol |
| IUPAC name | 3-(3-bromo-4-fluorophenyl)prop-2-enoic acid |
| InChIKey | ZNIGVADAKXOMQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=CC(=O)O)Br)F |
Computed by PubChem (NCBI)