CAS 2034166-37-3 is the registry number for (R)-3-Methyl-5-(piperidin-2-yl)-1,2,4-oxadiazole hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride (CAS 2034166-37-3) is a chemical compound with the molecular formula C8H14ClN3O and a molecular weight of 203.67 g/mol. IUPAC name: 3-methyl-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride. InChIKey: VNKGWZCRQRWCCJ-OGFXRTJISA-N.
| Molecular formula | C8H14ClN3O |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | 3-methyl-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole;hydrochloride |
| InChIKey | VNKGWZCRQRWCCJ-OGFXRTJISA-N |
| SMILES | CC1=NOC(=N1)[C@H]2CCCCN2.Cl |
Computed by PubChem (NCBI)