Products 160617-85-6
CAS 160617-85-6 is the registry number for 2-Chloro-1-(1,1-dimethylethoxy)-4-nitrobenzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2,5g.
2-chloro-1-[(2-methylpropan-2-yl)oxy]-4-nitrobenzene (CAS 160617-85-6) is a chemical compound with the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. IUPAC name: 2-chloro-1-[(2-methylpropan-2-yl)oxy]-4-nitrobenzene. InChIKey: CSIAHJGCOXQCNJ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 2-chloro-1-[(2-methylpropan-2-yl)oxy]-4-nitrobenzene |
| InChIKey | CSIAHJGCOXQCNJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=C(C=C(C=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)