CAS 1607436-56-5 appears in our catalog under these names: 5-ACetyl-2-(4-benzoylphenoxy) pyridine, 95%, 1-(6-(4-Benzoylphenoxy)pyridin-3-yl)ethan-1-one, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 250mg, 1g.
1-[6-(4-benzoylphenoxy)-3-pyridinyl]ethanone (CAS 1607436-56-5) is a chemical compound with the molecular formula C20H15NO3 and a molecular weight of 317.3 g/mol. IUPAC name: 1-[6-(4-benzoylphenoxy)-3-pyridinyl]ethanone. InChIKey: NGAMSMKWUMKFGZ-UHFFFAOYSA-N.
| Molecular formula | C20H15NO3 |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | 1-[6-(4-benzoylphenoxy)-3-pyridinyl]ethanone |
| InChIKey | NGAMSMKWUMKFGZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN=C(C=C1)OC2=CC=C(C=C2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)