CAS 6765-52-2 is the registry number for WAY-225588, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
3-hydroxy-3-(2-naphthalen-2-yl-2-oxoethyl)-1H-indol-2-one (CAS 6765-52-2) is a chemical compound with the molecular formula C20H15NO3 and a molecular weight of 317.3 g/mol. IUPAC name: 3-hydroxy-3-(2-naphthalen-2-yl-2-oxoethyl)-1H-indol-2-one. InChIKey: IVAVELBVHXCUDH-UHFFFAOYSA-N.
| Molecular formula | C20H15NO3 |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | 3-hydroxy-3-(2-naphthalen-2-yl-2-oxoethyl)-1H-indol-2-one |
| InChIKey | IVAVELBVHXCUDH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)CC3(C4=CC=CC=C4NC3=O)O |
Computed by PubChem (NCBI)