CAS 4727-31-5 appears in our catalog under these names: Kartogenin, >95% (HPLC), Kartogenin/ 97.79% (existing batch purity), Kartogenin, Kartogenin, >98.0%(HPLC)(T), Kartogenin 98%. Offered by: TRC, TargetMol, GLPBio, Thermo Scientific (Acros), TCI. Available pack sizes: 100mg, 10g, 2mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso).
2-[(4-phenylphenyl)carbamoyl]benzoic acid (CAS 4727-31-5) is a chemical compound with the molecular formula C20H15NO3 and a molecular weight of 317.3 g/mol. IUPAC name: 2-[(4-phenylphenyl)carbamoyl]benzoic acid. InChIKey: SLUINPGXGFUMLL-UHFFFAOYSA-N.
| Molecular formula | C20H15NO3 |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | 2-[(4-phenylphenyl)carbamoyl]benzoic acid |
| InChIKey | SLUINPGXGFUMLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC(=O)C3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)