CAS 2347639-55-6 is the registry number for 5-Acetyl-8-methyl-4-phenylpyrano[3,2-b]indol-2(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-acetyl-8-methyl-4-phenylpyrano[3,2-b]indol-2-one (CAS 2347639-55-6) is a chemical compound with the molecular formula C20H15NO3 and a molecular weight of 317.3 g/mol. IUPAC name: 5-acetyl-8-methyl-4-phenylpyrano[3,2-b]indol-2-one. InChIKey: VKMJBVMYUCCOTQ-UHFFFAOYSA-N.
| Molecular formula | C20H15NO3 |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | 5-acetyl-8-methyl-4-phenylpyrano[3,2-b]indol-2-one |
| InChIKey | VKMJBVMYUCCOTQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C3=C2OC(=O)C=C3C4=CC=CC=C4)C(=O)C |
Computed by PubChem (NCBI)