CAS 1609395-37-0 is the registry number for 2-(Hydroxymethyl)-4(3h)-quinazolinone hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(hydroxymethyl)-3H-quinazolin-4-one;hydrochloride (CAS 1609395-37-0) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: 2-(hydroxymethyl)-3H-quinazolin-4-one;hydrochloride. InChIKey: TYTXVJNYVTWBML-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 2-(hydroxymethyl)-3H-quinazolin-4-one;hydrochloride |
| InChIKey | TYTXVJNYVTWBML-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=N2)CO.Cl |
Computed by PubChem (NCBI)