Products 1609395-37-0

CAS 1609395-37-0 is the registry number for 2-(Hydroxymethyl)-4(3h)-quinazolinone hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(hydroxymethyl)-3H-quinazolin-4-one;hydrochloride (CAS 1609395-37-0) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: 2-(hydroxymethyl)-3H-quinazolin-4-one;hydrochloride. InChIKey: TYTXVJNYVTWBML-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClN2O2
Molecular weight212.63 g/mol
IUPAC name2-(hydroxymethyl)-3H-quinazolin-4-one;hydrochloride
InChIKeyTYTXVJNYVTWBML-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)NC(=N2)CO.Cl

Computed by PubChem (NCBI)