CAS 1609396-28-2 appears in our catalog under these names: tert-Butyl trans-4-amino-3-methyl-1-piperidinecarboxylate hydrochloride, 95%, trans-tert-Butyl 4-amino-3-methylpiperidine-1-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 250mg, 1g, 100mg.
Tert-butyl (3R,4R)-4-amino-3-methylpiperidine-1-carboxylate;hydrochloride (CAS 1609396-28-2) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl (3R,4R)-4-amino-3-methylpiperidine-1-carboxylate;hydrochloride. InChIKey: BJRKUDHNJGUHRE-VTLYIQCISA-N.
| Molecular formula | C11H23ClN2O2 |
|---|---|
| Molecular weight | 250.76 g/mol |
| IUPAC name | tert-butyl (3R,4R)-4-amino-3-methylpiperidine-1-carboxylate;hydrochloride |
| InChIKey | BJRKUDHNJGUHRE-VTLYIQCISA-N |
| SMILES | C[C@@H]1CN(CC[C@H]1N)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)