CAS 2504203-63-6 is the registry number for tert-Butyl ([1-(aminomethyl)cyclopropyl]methyl)methylcarbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Tert-butyl N-[[1-(aminomethyl)cyclopropyl]methyl]-N-methylcarbamate;hydrochloride (CAS 2504203-63-6) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl N-[[1-(aminomethyl)cyclopropyl]methyl]-N-methylcarbamate;hydrochloride. InChIKey: VZWMTUBXHLEUNC-UHFFFAOYSA-N.
| Molecular formula | C11H23ClN2O2 |
|---|---|
| Molecular weight | 250.76 g/mol |
| IUPAC name | tert-butyl N-[[1-(aminomethyl)cyclopropyl]methyl]-N-methylcarbamate;hydrochloride |
| InChIKey | VZWMTUBXHLEUNC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CC1(CC1)CN.Cl |
Computed by PubChem (NCBI)