CAS 78859-46-8 is the registry number for 2-((2S,5S)-5-isopropyl-3,6-dioxopiperazin-2-yl)acetic acid. Offered by: TRC. Available pack sizes: 100mg.
2-[(2S,5S)-3,6-dioxo-5-propan-2-ylpiperazin-2-yl]acetic acid (CAS 78859-46-8) is a chemical compound with the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. IUPAC name: 2-[(2S,5S)-3,6-dioxo-5-propan-2-ylpiperazin-2-yl]acetic acid. InChIKey: XPFDXOQLCBSANS-FSPLSTOPSA-N.
| Molecular formula | C9H14N2O4 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 2-[(2S,5S)-3,6-dioxo-5-propan-2-ylpiperazin-2-yl]acetic acid |
| InChIKey | XPFDXOQLCBSANS-FSPLSTOPSA-N |
| SMILES | CC(C)[C@H]1C(=O)N[C@H](C(=O)N1)CC(=O)O |
Computed by PubChem (NCBI)