Products 635728-10-8
CAS 635728-10-8 appears in our catalog under these names: 8-Nitro-1,4-dioxaspiro[4.5]decane, 95%, 8-Nitro-1,4-dioxaspiro(4.5)decane, 95+%, 8–Nitro–1，4–Dioxaspiro(4·5)Decane. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
8-nitro-1,4-dioxaspiro[4.5]decane (CAS 635728-10-8) is a chemical compound with the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. IUPAC name: 8-nitro-1,4-dioxaspiro[4.5]decane. InChIKey: QWKNDRYGFOFRES-UHFFFAOYSA-N.
| Molecular formula | C8H13NO4 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 8-nitro-1,4-dioxaspiro[4.5]decane |
| InChIKey | QWKNDRYGFOFRES-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1[N+](=O)[O-])OCCO2 |
Computed by PubChem (NCBI)