Products 1609453-63-5
CAS 1609453-63-5 is the registry number for 7-Bromo-5,6-dihydro-4H-imidazo[4,5,1-ij]quinolin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one (CAS 1609453-63-5) is a chemical compound with the molecular formula C10H9BrN2O and a molecular weight of 253.09 g/mol. IUPAC name: 7-bromo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one. InChIKey: KDLGHOMWSRZBOQ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 7-bromo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one |
| InChIKey | KDLGHOMWSRZBOQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC3=C2N(C1)C(=O)N3)Br |
Computed by PubChem (NCBI)