Products 1609462-20-5
CAS 1609462-20-5 appears in our catalog under these names: 5-(Cyclobutylmethoxy)pyrazine-2-carboxylic acid, 5-(Cyclobutylmethoxy)pyrazine-2-carboxylic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
5-(cyclobutylmethoxy)pyrazine-2-carboxylic acid (CAS 1609462-20-5) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 5-(cyclobutylmethoxy)pyrazine-2-carboxylic acid. InChIKey: IWGUSDGRXCBONN-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 5-(cyclobutylmethoxy)pyrazine-2-carboxylic acid |
| InChIKey | IWGUSDGRXCBONN-UHFFFAOYSA-N |
| SMILES | C1CC(C1)COC2=NC=C(N=C2)C(=O)O |
Computed by PubChem (NCBI)