Products 1609549-23-6
CAS 1609549-23-6 is the registry number for Boc-beta-fluoro-Phe-OH. Offered by: Iris Biotech. Available pack sizes: on request.
(2S,3S)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid (CAS 1609549-23-6) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: (2S,3S)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid. InChIKey: WBMMLSLUBCWSFY-WDEREUQCSA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | (2S,3S)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| InChIKey | WBMMLSLUBCWSFY-WDEREUQCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]([C@H](C1=CC=CC=C1)F)C(=O)O |
Computed by PubChem (NCBI)