CAS 1613051-36-7 appears in our catalog under these names: (2E)-3-[2,5-Dimethyl-1-(5-methylisoxazol-3-yl)-1h-pyrrol-3-yl]acrylic acid, 95%, (2E)-3-(2,5-Dimethyl-1-(5-methyl-1,2-oxazol-3-yl)-1H-pyrrol-3-yl)prop-2-enoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
(E)-3-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]prop-2-enoic acid (CAS 1613051-36-7) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: (E)-3-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]prop-2-enoic acid. InChIKey: KNWXGLFNPYEIDZ-SNAWJCMRSA-N.
| Molecular formula | C13H14N2O3 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | (E)-3-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]prop-2-enoic acid |
| InChIKey | KNWXGLFNPYEIDZ-SNAWJCMRSA-N |
| SMILES | CC1=CC(=C(N1C2=NOC(=C2)C)C)/C=C/C(=O)O |
Computed by PubChem (NCBI)