Products 161333-99-9
CAS 161333-99-9 is the registry number for 4-Chloro-2-isopropylpyrido(3,4-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg.
4-chloro-2-propan-2-ylpyrido[3,4-d]pyrimidine (CAS 161333-99-9) is a chemical compound with the molecular formula C10H10ClN3 and a molecular weight of 207.66 g/mol. IUPAC name: 4-chloro-2-propan-2-ylpyrido[3,4-d]pyrimidine. InChIKey: OOIPALNJRGYWBD-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3 |
|---|---|
| Molecular weight | 207.66 g/mol |
| IUPAC name | 4-chloro-2-propan-2-ylpyrido[3,4-d]pyrimidine |
| InChIKey | OOIPALNJRGYWBD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC2=C(C=CN=C2)C(=N1)Cl |
Computed by PubChem (NCBI)