CAS 1613380-42-9 appears in our catalog under these names: 2-Bromo-8-phenyl-[1,2,4]triazolo[1,5-a]pyridine, 98%, 98%, 2-Bromo-8-phenyl-[1,2,4]triazolo[1,5-a]pyridine, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
2-bromo-8-phenyl-[1,2,4]triazolo[1,5-a]pyridine (CAS 1613380-42-9) is a chemical compound with the molecular formula C12H8BrN3 and a molecular weight of 274.12 g/mol. IUPAC name: 2-bromo-8-phenyl-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: IKSNGEACZZVWSC-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN3 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 2-bromo-8-phenyl-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | IKSNGEACZZVWSC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CN3C2=NC(=N3)Br |
Computed by PubChem (NCBI)