Products 1613436-03-5
CAS 1613436-03-5 is the registry number for TNKS-2-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
4,5-dimethyl-3-phenyl-2H-isoquinolin-1-one (CAS 1613436-03-5) is a chemical compound with the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. IUPAC name: 4,5-dimethyl-3-phenyl-2H-isoquinolin-1-one. InChIKey: GRSACGLQNOTJPL-UHFFFAOYSA-N.
| Molecular formula | C17H15NO |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | 4,5-dimethyl-3-phenyl-2H-isoquinolin-1-one |
| InChIKey | GRSACGLQNOTJPL-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(NC(=O)C2=CC=C1)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)