CAS 161356-05-4 appears in our catalog under these names: 4-Hydroxy-N-phenylbenzenesulfonamide 98+%, 4-Hydroxy-N-phenylbenzenesulfonamide, 98%, 4-Hydroxy-N-phenylbenzenesulfonamide, 98+%, 98+%, P–hydroxybenzene sulfonyl anilide. Offered by: Ambeed, Fluorochem, Chemat, GLPBio. Available pack sizes: 25g, 100g, 500g, 50g.
4-hydroxy-N-phenylbenzenesulfonamide (CAS 161356-05-4) is a chemical compound with the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. IUPAC name: 4-hydroxy-N-phenylbenzenesulfonamide. InChIKey: ZCDVIQXSESHKES-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | 4-hydroxy-N-phenylbenzenesulfonamide |
| InChIKey | ZCDVIQXSESHKES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)