Products 1614262-83-7
CAS 1614262-83-7 appears in our catalog under these names: NITD-916, NITD–916, NITD-916/ 99.6% (existing batch purity), NITD-916, 99.83%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 500mg, 10mg, 1mg, 5mg, 25mg, 50mg, 10mM (in 1ml dmso), 100mg.
6-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-3-phenyl-1H-pyridin-2-one (CAS 1614262-83-7) is a chemical compound with the molecular formula C20H25NO2 and a molecular weight of 311.4 g/mol. IUPAC name: 6-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-3-phenyl-1H-pyridin-2-one. InChIKey: WKDRRKVUJLNFSR-UHFFFAOYSA-N.
| Molecular formula | C20H25NO2 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 6-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-3-phenyl-1H-pyridin-2-one |
| InChIKey | WKDRRKVUJLNFSR-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)CC2=CC(=C(C(=O)N2)C3=CC=CC=C3)O)C |
Computed by PubChem (NCBI)