Products 161450-84-6
CAS 161450-84-6 is the registry number for Boc-n-methyl-d-norleucine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoic acid (CAS 161450-84-6) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoic acid. InChIKey: HYGQYTQHPSQSFF-SECBINFHSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoic acid |
| InChIKey | HYGQYTQHPSQSFF-SECBINFHSA-N |
| SMILES | CCCC[C@H](C(=O)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)