Products 161453-37-8
CAS 161453-37-8 appears in our catalog under these names: (S)–2–((tert–butoxycarbonyl)amino)–3–(quinolin–2–yl)propanoic acid, (S)-2-((tert-Butoxycarbonyl)amino)-3-(quinolin-2-yl)propanoic acid, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-3-isoquinolin-3-yl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 161453-37-8) is a chemical compound with the molecular formula C17H20N2O4 and a molecular weight of 316.35 g/mol. IUPAC name: (2S)-3-isoquinolin-3-yl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: CHNLRODZPDTMRV-AWEZNQCLSA-N.
| Molecular formula | C17H20N2O4 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | (2S)-3-isoquinolin-3-yl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | CHNLRODZPDTMRV-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC2=CC=CC=C2C=N1)C(=O)O |
Computed by PubChem (NCBI)