CAS 161479-50-1 appears in our catalog under these names: Boc-l-beta-methylisoleucine, 95%, Boc-beta-Me-L-Ile-OH, Boc-β-Me-Ile-OH 95%. Offered by: Combi-blocks, Iris Biotech, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 161479-50-1) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: WZKPSAWKRJWANR-MRVPVSSYSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | WZKPSAWKRJWANR-MRVPVSSYSA-N |
| SMILES | CCC(C)(C)[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)