Products 161494-74-2

CAS 161494-74-2 is the registry number for Methanesulfonic acid 2-benzyloxycarbonylamino-propyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(phenylmethoxycarbonylamino)propyl methanesulfonate (CAS 161494-74-2) is a chemical compound with the molecular formula C12H17NO5S and a molecular weight of 287.33 g/mol. IUPAC name: 2-(phenylmethoxycarbonylamino)propyl methanesulfonate. InChIKey: TXFACSSUKSDROL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO5S
Molecular weight287.33 g/mol
IUPAC name2-(phenylmethoxycarbonylamino)propyl methanesulfonate
InChIKeyTXFACSSUKSDROL-UHFFFAOYSA-N
SMILESCC(COS(=O)(=O)C)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)