Products 784172-00-5
CAS 784172-00-5 appears in our catalog under these names: 3-[(tert-Butylamino)sulfonyl]-4-methoxybenzoic acid, 95%, 3-(tert-Butylsulfamoyl)-4-methoxybenzoic acid, 95%, 3-(tert-Butylsulfamoyl)-4-methoxybenzoic acid, 3-(tert-Butylsulfamoyl)-4-methoxybenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-(tert-butylsulfamoyl)-4-methoxybenzoic acid (CAS 784172-00-5) is a chemical compound with the molecular formula C12H17NO5S and a molecular weight of 287.33 g/mol. IUPAC name: 3-(tert-butylsulfamoyl)-4-methoxybenzoic acid. InChIKey: TURYCNVSEWGTMU-UHFFFAOYSA-N.
| Molecular formula | C12H17NO5S |
|---|---|
| Molecular weight | 287.33 g/mol |
| IUPAC name | 3-(tert-butylsulfamoyl)-4-methoxybenzoic acid |
| InChIKey | TURYCNVSEWGTMU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=C(C=CC(=C1)C(=O)O)OC |
Computed by PubChem (NCBI)