CAS 197965-89-2 appears in our catalog under these names: 2-(4-Methoxybenzenesulfonamido)-3-methylbutanoic acid, 2-(4-Methoxyphenylsulfonamido)-3-methylbutanoic acid, 97%, 2-([(4-Methoxyphenyl)sulfonyl]amino)-3-methylbutanoic acid, 95%. Offered by: Biosynth, AmBeed, Combi-blocks. Available pack sizes: 100mg, 1g, 5g, 10g, 250mg.
2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoic acid (CAS 197965-89-2) is a chemical compound with the molecular formula C12H17NO5S and a molecular weight of 287.33 g/mol. IUPAC name: 2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoic acid. InChIKey: MMAMULOKFLYVHG-UHFFFAOYSA-N.
| Molecular formula | C12H17NO5S |
|---|---|
| Molecular weight | 287.33 g/mol |
| IUPAC name | 2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoic acid |
| InChIKey | MMAMULOKFLYVHG-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)