CAS 105838-14-0 appears in our catalog under these names: tert-Butyl ([(4-methylphenyl)sulfonyl]oxy)carbamate, 98%, tert-Butyl N-Tosyloxycarbamate, N-Boc-O-tosyl hydroxylamine/ 99.76% (existing batch purity), N–Boc–O–tosyl hydroxylamine, N-Boc-O-tosylhydroxylamine 95%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Sigma-Aldrich. Available pack sizes: 100g, 1g, 5g, 25g, 250mg, 500mg, 100mg, 10g.
[(2-methylpropan-2-yl)oxycarbonylamino] 4-methylbenzenesulfonate (CAS 105838-14-0) is a chemical compound with the molecular formula C12H17NO5S and a molecular weight of 287.33 g/mol. IUPAC name: [(2-methylpropan-2-yl)oxycarbonylamino] 4-methylbenzenesulfonate. InChIKey: WZDPZKPHVNFUKB-UHFFFAOYSA-N.
| Molecular formula | C12H17NO5S |
|---|---|
| Molecular weight | 287.33 g/mol |
| IUPAC name | [(2-methylpropan-2-yl)oxycarbonylamino] 4-methylbenzenesulfonate |
| InChIKey | WZDPZKPHVNFUKB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)ONC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)