Products 1616752-18-1
CAS 1616752-18-1 appears in our catalog under these names: 4-Amino-2-methoxynaphthalen-1-ol hydrochloride, 4-Amino-2-methoxynaphthalen-1-ol hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
4-amino-2-methoxynaphthalen-1-ol;hydrochloride (CAS 1616752-18-1) is a chemical compound with the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. IUPAC name: 4-amino-2-methoxynaphthalen-1-ol;hydrochloride. InChIKey: NPNFNNXVZGVLLO-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO2 |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | 4-amino-2-methoxynaphthalen-1-ol;hydrochloride |
| InChIKey | NPNFNNXVZGVLLO-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=CC=CC=C2C(=C1)N)O.Cl |
Computed by PubChem (NCBI)