Products 1617-55-6
CAS 1617-55-6 is the registry number for Gallocatechin. Offered by: Sigma-Aldrich. Available pack sizes: 10MG.
Gallocatechin is a catechin that is a flavan substituted by hydroxy groups at positions 3, 3', 4', 5, 5' and 7 (the trans isomer). It is isolated from Acacia mearnsii. It has a role as a metabolite. It is a catechin and a flavan-3,3',4',5,5',7-hexol.
Source: ChEBI
| Molecular formula | C15H14O7 |
|---|---|
| Molecular weight | 306.27 g/mol |
| IUPAC name | (2R,3S)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| InChIKey | XMOCLSLCDHWDHP-SWLSCSKDSA-N |
| SMILES | C1[C@@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
(+)-Gallocatechin, Gallocatechin, Gallocatechol, (+)-gallocatechol, (2R,3S)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol, (2R,3S)-gallocatechin, 2H-1-Benzopyran-3,5,7-triol, 3,4-dihydro-2-(3,4,5-trihydroxyphenyl)-, (2R,3S)-, d-Gallocatechin, Gallocatechol, (+-)-, (2R,3S)-2-(3,4,5-trihydroxyphenyl)chromane-3,5,7-triol