Products 1617-93-2
CAS 1617-93-2 appears in our catalog under these names: 5-(2-Phenylethyl)-1,3,4-oxadiazol-2-amine, 5-(2-Phenylethyl)-1,3,4-oxadiazol-2-amine, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 5g, 1g, 10g, 250mg, 100mg.
5-(2-phenylethyl)-1,3,4-oxadiazol-2-amine (CAS 1617-93-2) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: 5-(2-phenylethyl)-1,3,4-oxadiazol-2-amine. InChIKey: HOUJXRMAYWZMHT-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 5-(2-phenylethyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | HOUJXRMAYWZMHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=NN=C(O2)N |
Computed by PubChem (NCBI)