CAS 161712-77-2 appears in our catalog under these names: 5,6–difluoro–2,3–dihydroinden–1–one, 5,6-Difluoro-2,3-dihydro-1H-inden-1-one 97%, 5,6-DIFLUORO-1-INDANONE, 97%, 97%, 5,6-Difluoro-1-indanone, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 100g, 50g.
5,6-difluoro-2,3-dihydroinden-1-one (CAS 161712-77-2) is a chemical compound with the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. IUPAC name: 5,6-difluoro-2,3-dihydroinden-1-one. InChIKey: OSJRTWXVMCRBKZ-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O |
|---|---|
| Molecular weight | 168.14 g/mol |
| IUPAC name | 5,6-difluoro-2,3-dihydroinden-1-one |
| InChIKey | OSJRTWXVMCRBKZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=C(C=C21)F)F |
Computed by PubChem (NCBI)