Products 161712-79-4
CAS 161712-79-4 is the registry number for 5,6-Difluoro-indan-2-one. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg.
5,6-difluoro-1,3-dihydroinden-2-one (CAS 161712-79-4) is a chemical compound with the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. IUPAC name: 5,6-difluoro-1,3-dihydroinden-2-one. InChIKey: FPOCXYWEBBMGFD-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O |
|---|---|
| Molecular weight | 168.14 g/mol |
| IUPAC name | 5,6-difluoro-1,3-dihydroinden-2-one |
| InChIKey | FPOCXYWEBBMGFD-UHFFFAOYSA-N |
| SMILES | C1C(=O)CC2=CC(=C(C=C21)F)F |
Computed by PubChem (NCBI)