Products 161774-09-0
CAS 161774-09-0 is the registry number for PD 142505-0028. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-N-[3-(3-methoxyphenyl)prop-2-ynoxy]-1-azabicyclo[2.2.1]heptan-3-imine;oxalic acid (CAS 161774-09-0) is a chemical compound with the molecular formula C18H20N2O6 and a molecular weight of 360.4 g/mol. IUPAC name: (E)-N-[3-(3-methoxyphenyl)prop-2-ynoxy]-1-azabicyclo[2.2.1]heptan-3-imine;oxalic acid. InChIKey: FSSMLDVGDZVSES-XYJRJTJESA-N.
| Molecular formula | C18H20N2O6 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | (E)-N-[3-(3-methoxyphenyl)prop-2-ynoxy]-1-azabicyclo[2.2.1]heptan-3-imine;oxalic acid |
| InChIKey | FSSMLDVGDZVSES-XYJRJTJESA-N |
| SMILES | COC1=CC=CC(=C1)C#CCO/N=C\2/CN3CCC2C3.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)