Products 53055-15-5
CAS 53055-15-5 appears in our catalog under these names: Nitrendipine Impurity 12, Nitrendipine Impurity 1, Nitrendipine Impurity 7. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 53055-15-5) is a chemical compound with the molecular formula C18H20N2O6 and a molecular weight of 360.4 g/mol. IUPAC name: 5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: ZZVDQTCQGYISLQ-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O6 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | ZZVDQTCQGYISLQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2[N+](=O)[O-])C(=O)OC)C)C |
Computed by PubChem (NCBI)
Synonyms:
Nitrendipine Impurity 12