Products 2469554-26-3
CAS 2469554-26-3 appears in our catalog under these names: Nitrendipine-d5, Nitrendipine–d5, Nitrendipine-d5, 99.77%. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 5mg, 100 μg, 10 mg, 5 mg, 1 mg.
3-O-methyl 5-O-(1,1,2,2,2-pentadeuterioethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 2469554-26-3) is a chemical compound with the molecular formula C18H20N2O6 and a molecular weight of 365.4 g/mol. IUPAC name: 3-O-methyl 5-O-(1,1,2,2,2-pentadeuterioethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: PVHUJELLJLJGLN-RPIBLTHZSA-N.
| Molecular formula | C18H20N2O6 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 3-O-methyl 5-O-(1,1,2,2,2-pentadeuterioethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | PVHUJELLJLJGLN-RPIBLTHZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)C1=C(NC(=C(C1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC)C)C |
Computed by PubChem (NCBI)
Synonyms:
Nitrendipine-d5