Products 39562-29-3

CAS 39562-29-3 is the registry number for Nitrendipine Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 39562-29-3) is a chemical compound with the molecular formula C18H20N2O6 and a molecular weight of 360.4 g/mol. IUPAC name: 5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: OUYHHVXCWZAPMH-UHFFFAOYSA-N.

Identity
Molecular formulaC18H20N2O6
Molecular weight360.4 g/mol
IUPAC name5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
InChIKeyOUYHHVXCWZAPMH-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(NC(=C(C1C2=CC=C(C=C2)[N+](=O)[O-])C(=O)OC)C)C

Computed by PubChem (NCBI)