CAS 39562-29-3 is the registry number for Nitrendipine Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 39562-29-3) is a chemical compound with the molecular formula C18H20N2O6 and a molecular weight of 360.4 g/mol. IUPAC name: 5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: OUYHHVXCWZAPMH-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O6 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | OUYHHVXCWZAPMH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC=C(C=C2)[N+](=O)[O-])C(=O)OC)C)C |
Computed by PubChem (NCBI)