Products 80890-07-9
CAS 80890-07-9 is the registry number for (+)-Nitrendipine. Offered by: TRC. Available pack sizes: 25mg.
5-O-ethyl 3-O-methyl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 80890-07-9) is a chemical compound with the molecular formula C18H20N2O6 and a molecular weight of 360.4 g/mol. IUPAC name: 5-O-ethyl 3-O-methyl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: PVHUJELLJLJGLN-MRXNPFEDSA-N.
| Molecular formula | C18H20N2O6 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 5-O-ethyl 3-O-methyl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | PVHUJELLJLJGLN-MRXNPFEDSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C([C@H]1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC)C)C |
Computed by PubChem (NCBI)