CAS 16191-61-0 is the registry number for Isopropyl({2-[(4-methylbenzene)sulfonyl]ethyl})amine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-[2-(4-methylphenyl)sulfonylethyl]propan-2-amine (CAS 16191-61-0) is a chemical compound with the molecular formula C12H19NO2S and a molecular weight of 241.35 g/mol. IUPAC name: N-[2-(4-methylphenyl)sulfonylethyl]propan-2-amine. InChIKey: IKPAVDUNPTZDCN-UHFFFAOYSA-N.
| Molecular formula | C12H19NO2S |
|---|---|
| Molecular weight | 241.35 g/mol |
| IUPAC name | N-[2-(4-methylphenyl)sulfonylethyl]propan-2-amine |
| InChIKey | IKPAVDUNPTZDCN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CCNC(C)C |
Computed by PubChem (NCBI)