CAS 2137628-38-5 is the registry number for N,3-Dimethyl-1-phenylbutane-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N,3-dimethyl-1-phenylbutane-1-sulfonamide (CAS 2137628-38-5) is a chemical compound with the molecular formula C12H19NO2S and a molecular weight of 241.35 g/mol. IUPAC name: N,3-dimethyl-1-phenylbutane-1-sulfonamide. InChIKey: FUZANQURCPLYAU-UHFFFAOYSA-N.
| Molecular formula | C12H19NO2S |
|---|---|
| Molecular weight | 241.35 g/mol |
| IUPAC name | N,3-dimethyl-1-phenylbutane-1-sulfonamide |
| InChIKey | FUZANQURCPLYAU-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C1=CC=CC=C1)S(=O)(=O)NC |
Computed by PubChem (NCBI)