CAS 852840-30-3 appears in our catalog under these names: 4-tert-Butyl-2,6-dimethylbenzene-1-sulfonamide, 95%, 4-tert-Butyl-2,6-dimethylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-tert-butyl-2,6-dimethylbenzenesulfonamide (CAS 852840-30-3) is a chemical compound with the molecular formula C12H19NO2S and a molecular weight of 241.35 g/mol. IUPAC name: 4-tert-butyl-2,6-dimethylbenzenesulfonamide. InChIKey: ROUPAKVULVAJAP-UHFFFAOYSA-N.
| Molecular formula | C12H19NO2S |
|---|---|
| Molecular weight | 241.35 g/mol |
| IUPAC name | 4-tert-butyl-2,6-dimethylbenzenesulfonamide |
| InChIKey | ROUPAKVULVAJAP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1S(=O)(=O)N)C)C(C)(C)C |
Computed by PubChem (NCBI)