CAS 189341-65-9 appears in our catalog under these names: 2,4,6-Trimethyl-N-propylbenzene-1-sulfonamide, 95%, 2,4,6-Trimethyl-N-propylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2,4,6-trimethyl-N-propylbenzenesulfonamide (CAS 189341-65-9) is a chemical compound with the molecular formula C12H19NO2S and a molecular weight of 241.35 g/mol. IUPAC name: 2,4,6-trimethyl-N-propylbenzenesulfonamide. InChIKey: XPORVZICKZCHLQ-UHFFFAOYSA-N.
| Molecular formula | C12H19NO2S |
|---|---|
| Molecular weight | 241.35 g/mol |
| IUPAC name | 2,4,6-trimethyl-N-propylbenzenesulfonamide |
| InChIKey | XPORVZICKZCHLQ-UHFFFAOYSA-N |
| SMILES | CCCNS(=O)(=O)C1=C(C=C(C=C1C)C)C |
Computed by PubChem (NCBI)