Products 1620075-07-1
CAS 1620075-07-1 is the registry number for 7-Bromochromane-4-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-bromo-3,4-dihydro-2H-chromene-4-carboxylic acid (CAS 1620075-07-1) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: 7-bromo-3,4-dihydro-2H-chromene-4-carboxylic acid. InChIKey: QIIWYYYGKGEGBY-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 7-bromo-3,4-dihydro-2H-chromene-4-carboxylic acid |
| InChIKey | QIIWYYYGKGEGBY-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1C(=O)O)C=CC(=C2)Br |
Computed by PubChem (NCBI)