CAS 1620128-80-4 is the registry number for Rel-1-(tert-butyl) 3-methyl (3S,4S)-4-aminopiperidine-1,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 3-O-methyl (3S,4S)-4-aminopiperidine-1,3-dicarboxylate (CAS 1620128-80-4) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S,4S)-4-aminopiperidine-1,3-dicarboxylate. InChIKey: NBPKQJCULPQVNO-IUCAKERBSA-N.
| Molecular formula | C12H22N2O4 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3S,4S)-4-aminopiperidine-1,3-dicarboxylate |
| InChIKey | NBPKQJCULPQVNO-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@H](C1)C(=O)OC)N |
Computed by PubChem (NCBI)