CAS 362489-61-0 appears in our catalog under these names: 1-(tert-Butyl) 3-methyl (3S,4R)-4-aminopiperidine-1,3-dicarboxylate, 98%, 1-(tert-Butyl) 3-methyl (3S,4R)-4-aminopiperidine-1,3-dicarboxylate, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 25mg, 50mg.
1-O-tert-butyl 3-O-methyl (3S,4R)-4-aminopiperidine-1,3-dicarboxylate (CAS 362489-61-0) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S,4R)-4-aminopiperidine-1,3-dicarboxylate. InChIKey: NBPKQJCULPQVNO-DTWKUNHWSA-N.
| Molecular formula | C12H22N2O4 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3S,4R)-4-aminopiperidine-1,3-dicarboxylate |
| InChIKey | NBPKQJCULPQVNO-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)C(=O)OC)N |
Computed by PubChem (NCBI)