CAS 1620678-03-6 appears in our catalog under these names: Methyl 3-acetyl-4-bromobenzoate, 95%, 95%, METHYL 4-BROMO-3-ACETYLBENZOATE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
Methyl 3-acetyl-4-bromobenzoate (CAS 1620678-03-6) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: methyl 3-acetyl-4-bromobenzoate. InChIKey: QQEZIPVFHCDBCX-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | methyl 3-acetyl-4-bromobenzoate |
| InChIKey | QQEZIPVFHCDBCX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)